2-Methyl-3-pyridinecarboxylic acid ethyl ester
ethyl 2-methylnicotinate
CAS: 1721-26-2
Molecular Formula: C9H11NO2
2-Methyl-3-pyridinecarboxylic acid ethyl ester - Names and Identifiers
| Name | ethyl 2-methylnicotinate |
| Synonyms | ethyl 2-methylnicotinate ETHYL 2-METHYLNICOTINATE Ethyl 2-methylnicotinate 2-methylnicotin ethyl ester 2-METHYLNICOTINIC ACID ETHYL ESTER 2-Methylnicotinic acid ethyl ester ethyl 2-methylpyridine-3-carboxylate 2-Methyl-3-pyridinecarboxylic acid ethyl ester 2-Methylpyridine-3-carboxylic acid ethyl ester 3-Pyridinecarboxylic acid, 2-methyl-, ethyl ester Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester |
| CAS | 1721-26-2 |
| EINECS | 217-013-4 |
| InChI | InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
2-Methyl-3-pyridinecarboxylic acid ethyl ester - Physico-chemical Properties
| Molecular Formula | C9H11NO2 |
| Molar Mass | 165.19 |
| Density | 1.072g/mLat 25°C(lit.) |
| Melting Point | 146-147 °C |
| Boling Point | 126-127°C24mm Hg(lit.) |
| Flash Point | 217°F |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.0521mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to orange |
| Maximum wavelength(λmax) | 268nm(EtOH)(lit.) |
| BRN | 118200 |
| pKa | 4.02±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | n20/D 1.505(lit.) |
2-Methyl-3-pyridinecarboxylic acid ethyl ester - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29333990 |
